z1-Indanone, 5,6-dimethoxy-3,3-dimethyl-
5,6-dimethoxy-3,3-dimethyl-2H-inden-1-one
Also Known As: 5,6-Dimethoxy-3,3-dimethyl-2,3-dihydro-1H-inden-1-one|5,6-dimethoxy-3,3-dimethyl-2H-inden-1-one|z1-Indanone, 5,6-dimethoxy-3,3-dimethyl-|KS-00000QJS|5,6-dimethoxy-3,3-dimethyl-1-indanone|3,3-dimethyl-5,6-dimethoxy-1-indanone|5,6-dimethoxy-3,3-dimethylindan-1-one|5,6-dimethoxy-3,3-dimethyl-indan-1-one|4CH-012033|J2.157.862B|z1-Indanone, 5,6-dimethoxy-3,3-dimethyl-,|56-Dimethoxy-33-dimethyl-23-dihydro-1H-inden-1-one|2,3-Dihydro-5,6-dimethoxy-3,3-dimethyl-1H-inden-1-one|5 pound not6-Dimethoxy-3 pound not3-dimethyl-2 pound not3-dihydro-1H-inden-1-one
| Molecular Formula | C13H16O3 |
|---|---|
| Molecular Weight | 220.10994 g/mol |
| LogP | 2.5 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Exact Mass | 220.10994 |
| Monoisotopic Mass | 220.10994 |
| Heavy Atoms | 16 |
| Complexity | 285.0 |
Chemical Identifiers
| CAS Number | 4136-26-9 |
|---|---|
| SMILES | CC1(CC(=O)C2=CC(=C(C=C21)OC)OC)C |
| InChIKey | KYEDLQFODOWDRO-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
z1-Indanone, 5,6-dimethoxy-3,3-dimethyl- (CAS 4136-26-9), with molecular formula C13H16O3 and molecular weight 220.10994 g/mol. IUPAC: 5,6-dimethoxy-3,3-dimethyl-2H-inden-1-one.