Ethyl 2-chloro-3-oxo-3-phenylpropanoate
ethyl 2-chloro-3-oxo-3-phenylpropanoate
Also Known As: ethyl 2-chloro-3-oxo-3-phenylpropanoate|ethyl 2-chlorobenzoylacetate|Benzoylchloroacetic acid ethyl ester|Chlorobenzoylacetic acid ethyl ester|3-Phenyl-2-chloro-3-oxopropionic acid ethyl ester|alpha-chlorobenzoylacetic acid ethyl ester|Ethyl 2-chloro-3-oxo-3-phenyl-propanoate|ethyl 2-chloro-3-oxo-3-phenylpropionate|2-chloro-3-phenyl-propionic acid ethyl ester|3-Phenyl-2-chloro-3-oxopropionicacidethylester|Benzenepropanoic acid, alpha-chloro-beta-oxo-, ethyl ester|2-Chloro-3-oxo-3-phenylpropanoic acid ethyl ester|2-Chloro-3-phenyl-3-oxopropanoic acid ethyl ester|3-phenyl-2-chloro-3-oxopropanoic acid ethyl ester|2-chloro-3-oxo-3-phenyl-propionic acid ethyl ester|alpha-Chloro-beta-oxobenzenepropanoic acid ethyl ester|alpha-Chloro-beta-oxobenzenepropionic acid ethyl ester|2-Chloro-3-oxo-3-pyridin-3-yl-propionic acid ethyl ester
| Molecular Formula | C11H11ClO3 |
|---|---|
| Molecular Weight | 226.03967 g/mol |
| LogP | 2.0398 |
| Topological Polar Surface Area | 43.37 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 226.03967 |
| Monoisotopic Mass | 226.03967 |
| Heavy Atoms | 15 |
| Complexity | 348.11047 |
Chemical Identifiers
| CAS Number | 41381-97-9 |
|---|---|
| SMILES | CCOC(=O)C(C(=O)C1=CC=CC=C1)Cl |
Product Overview
Ethyl 2-chloro-3-oxo-3-phenylpropanoate (CAS 41381-97-9), with molecular formula C11H11ClO3 and molecular weight 226.03967 g/mol. IUPAC: ethyl 2-chloro-3-oxo-3-phenylpropanoate.
Ethyl 2-chloro-3-oxo-3-phenylpropanoate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »