D-Ribose 5-phosphate
[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate
Also Known As: D-Ribose 5-phosphate|Ribose 5-phosphate|D-ribofuranose 5-phosphate|D-ribose-5-P|ribose-5-phosphate|ribose-5-P|D-ribose 5'-phosphate|GlyTouCan:G46575RX|bmse000204|Epitope ID:581505|d-ribofuranose 5-O-phosphate|5-O-Phosphono-D-ribofuranose|D-ribofuranose-5-phosphoric acid|D-Ribofuranose 5-phosphoric acid|G46575RX|D-ribofuranose 5-(dihydrogen phosphate)|D-ribofuranose, 5-(dihydrogen phosphate)|{[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methoxy}phosphonic acid|[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate|D-ribofuranose 5-phosphate (closed ring structure, partial stereochemistry)
| Molecular Formula | C5H11O8P |
|---|---|
| Molecular Weight | 230.01915 g/mol |
| LogP | -3.6 |
| Topological Polar Surface Area | 137.0 Ų |
| Hydrogen Bond Donors | 5 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Exact Mass | 230.01915 |
| Monoisotopic Mass | 230.01915 |
| Heavy Atoms | 14 |
| Complexity | 238.0 |
Chemical Identifiers
| CAS Number | 4151-19-3 |
|---|---|
| SMILES | C([C@@H]1[C@H]([C@H](C(O1)O)O)O)OP(=O)(O)O |
| InChIKey | KTVPXOYAKDPRHY-SOOFDHNKSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
D-Ribose 5-phosphate (CAS 4151-19-3), with molecular formula C5H11O8P and molecular weight 230.01915 g/mol. IUPAC: [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl dihydrogen phosphate.