Benzenesulfonamide, 4-amino-2-chloro-5-hydroxy-
4-amino-2-chloro-5-hydroxybenzenesulfonamide
Also Known As: 4-amino-2-chloro-5-hydroxybenzenesulfonamide|4-Amino-2-chloro-5-hydroxybenzensulfonamide|Benzenesulfonamide, 4-amino-2-chloro-5-hydroxy-|2-Aminophenol-4-chloro-5-sulfonamide|2-amino-4-chlorophenol-5-sulphonamide|2-Amino-4-chloro-5-sulfamoylphenol|4-Amino-2-chloro-5-hydroxybenzenesulphonamide|L618|4-amino-2-chloro-5-hydroxybenzene-1-sulfonamide|2-[2-ethylhexyl(2-hydroxyethyl)amino]ethanol|4-amino-2-chloro-5-hydroxy-benzenesulfonamide|4-CHLORO-2-AMINOPHENOL-5-SULFONAMIDE|Benzenesulfonamide,4-amino-2-chloro-5-hydroxy-|606A659|N-<2-Diethylamino-ethyl>-4.5.6.7-tetrachlor-isoindolin
| Molecular Formula | C6H7ClN2O3S |
|---|---|
| Molecular Weight | 221.98659 g/mol |
| LogP | 0.1 |
| Topological Polar Surface Area | 115.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 221.98659 |
| Monoisotopic Mass | 221.98659 |
| Heavy Atoms | 13 |
| Complexity | 276.0 |
Chemical Identifiers
| CAS Number | 41607-08-3 |
|---|---|
| SMILES | C1=C(C(=CC(=C1Cl)S(=O)(=O)N)O)N |
| InChIKey | WUDOEWHXJCBYJH-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzenesulfonamide, 4-amino-2-chloro-5-hydroxy- (CAS 41607-08-3), with molecular formula C6H7ClN2O3S and molecular weight 221.98659 g/mol. IUPAC: 4-amino-2-chloro-5-hydroxybenzenesulfonamide.
Benzenesulfonamide, 4-amino-2-chloro-5-hydroxy- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »