Pseudourea, 2-ethyl-2-thio-, ethylenebis(O-ethylphosphite) (2:1)
ethoxy-[2-[ethoxy(hydroxy)phosphoryl]ethyl]phosphinic acid;ethyl carbamimidothioate
Also Known As: 2-Ethyl-2-thiopseudourea ethylenebis(O-ethylphosphite) (2:1)|Ethylene-bis-O-ethylphosphite-bis-S-ethyl-isothiuronium|Pseudourea, 2-ethyl-2-thio-, ethylenebis(O-ethylphosphite) (2:1)|diethyl ethane-1,2-diylbis[hydrogen(phosphonate)]- ethyl carbamimidothioate(1:2)|Diethyl ethane-1,2-diylbis[hydrogen (phosphonate)]--ethyl carbamimidothioate (1/2)|ethoxy-[2-[ethoxy(hydroxy)phosphoryl]ethyl]phosphinic acid; ethyl carbamimidothioate
| Molecular Formula | C12H32N4O6P2S2 |
|---|---|
| Molecular Weight | 454.12384 g/mol |
| LogP | 2.69614 |
| Topological Polar Surface Area | 243.0 Ų |
| Hydrogen Bond Donors | 6 |
| Hydrogen Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Exact Mass | 454.12384 |
| Monoisotopic Mass | 454.12384 |
| Heavy Atoms | 26 |
| Complexity | 279.0 |
Chemical Identifiers
| CAS Number | 41789-38-2 |
|---|---|
| SMILES | CCOP(=O)(CCP(=O)(O)OCC)O.CCSC(=N)N.CCSC(=N)N |
| InChIKey | ASGNURJWDGFUQS-UHFFFAOYSA-N |
Product Overview
Pseudourea, 2-ethyl-2-thio-, ethylenebis(O-ethylphosphite) (2:1) (CAS 41789-38-2), with molecular formula C12H32N4O6P2S2 and molecular weight 454.12384 g/mol. IUPAC: ethoxy-[2-[ethoxy(hydroxy)phosphoryl]ethyl]phosphinic acid;ethyl carbamimidothioate.