Phenyl 4-methoxybenzoate
phenyl 4-methoxybenzoate
Also Known As: Phenyl 4-methoxybenzoate|Anisalol|phenyl p-anisate|4-Methoxy-benzoic acid phenyl ester|Phenyl4-Methoxybenzoate|4-methoxybenzoic acid phenyl ester|anisic acid phenyl ester|phenyl-4-methoxybenzoate|p-Anisic acid, phenyl ester|p-Anisic acid phenyl ester|Phenyl 4-methoxybenzoate #|4-Methoxybenzoic acid phenyl|CBDivE_014078|p-Methoxybenzoic acid, phenyl ester|BNZYBNYNPXKWCM-UHFFFAOYSA-|4-METHOXY-BENZOICACIDPHENYLESTER|KS-00000BY8|Benzoic acid, 4-methoxy-, phenyl ester|Benzoic acid,4-methoxy-,phenyl ester|CS-W001020|DS-7068|4CH-017768|SR-01000195440-1
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.07864 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 35.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 228.07864 |
| Monoisotopic Mass | 228.07864 |
| Heavy Atoms | 17 |
| Complexity | 238.0 |
Chemical Identifiers
| CAS Number | 4181-97-9 |
|---|---|
| SMILES | COC1=CC=C(C=C1)C(=O)OC2=CC=CC=C2 |
| InChIKey | BNZYBNYNPXKWCM-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 7 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Phenyl 4-methoxybenzoate (CAS 4181-97-9), with molecular formula C14H12O3 and molecular weight 228.07864 g/mol. IUPAC: phenyl 4-methoxybenzoate.