5-Phenyl-o-anisidine
2-methoxy-5-phenylaniline
Also Known As: 5-Phenyl-o-anisidine|3-Amino-4-methoxybiphenyl|2-Methoxy-5-phenylaniline|4-Methoxy-[1,1'-biphenyl]-3-amine|4-methoxybiphenyl-3-amine|2-Amino-4-phenylanisole|5-phenyl-2-anisidine|4-methoxy-3-biphenylamine|3-amino-4-methoxy-biphenyl|2-methoxy-5-phenylphenylamine|BIDD:GT0535|TIMTEC-BB SBB000386|5-Phenyl-o-anisidine, >=98%|4-methoxy(1,1'-biphenyl)-3-amine|4-Methoxy[1,1'-biphenyl]-3-amine|(1,1'-Biphenyl)-3-amine, 4-methoxy-|[1,1'-Biphenyl]-3-amine, 4-methoxy-|5239AB|CA-110|2-(2-Bromophenyl)indane-1,3-dione|4-Methoxy-1,1 -biphenyl-3-amine|FS-4467|[1,1'-Biphenyl]-3-amine,4-methoxy-
| Molecular Formula | C13H13NO |
|---|---|
| Molecular Weight | 199.09972 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 35.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 199.09972 |
| Monoisotopic Mass | 199.09972 |
| Heavy Atoms | 15 |
| Complexity | 189.0 |
Chemical Identifiers
| CAS Number | 41998-16-7 |
|---|---|
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)N |
| InChIKey | DTYBRSLINXBXMP-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 11 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
5-Phenyl-o-anisidine (CAS 41998-16-7), with molecular formula C13H13NO and molecular weight 199.09972 g/mol. IUPAC: 2-methoxy-5-phenylaniline.