2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluorononanoyl chloride
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl chloride
Also Known As: 9h-perfluorononanoyl chloride|9H-Hexadecafluorononanoyl chloride|C9HClF16O|EINECS 207-033-1|2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluorononanoyl chloride|FS-4417|9H-HEXADECAFLUORONONANOYLCHLORIDE|3-HYDROXY-2,4-DIMETHYL-1-PHENYL-PENTAN-1-ONE|2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluorononanoic acid chloride|Nonanoyl chloride,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-|207-033-1
| Molecular Formula | C9HClF16O |
|---|---|
| Molecular Weight | 463.94604 g/mol |
| LogP | 5.464 |
| Topological Polar Surface Area | 17.07 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Exact Mass | 463.94604 |
| Monoisotopic Mass | 463.94604 |
| Heavy Atoms | 27 |
| Complexity | 580.44 |
Chemical Identifiers
| CAS Number | 423-95-0 |
|---|---|
| SMILES | C(C(C(C(C(C(C(C(C(=O)Cl)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Product Overview
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluorononanoyl chloride (CAS 423-95-0), with molecular formula C9HClF16O and molecular weight 463.94604 g/mol. IUPAC: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoyl chloride.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-Hexadecafluorononanoyl chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »