1-(4-Benzoylpiperazin-1-yl)-2-(3-methylphenoxy)ethanone
1-(4-benzoylpiperazin-1-yl)-2-(3-methylphenoxy)ethanone
Also Known As: Oprea1_253074|BAS 04057167|1-(4-Benzoyl-1-piperazinyl)-2-(3-methylphenoxy)ethanone|1-(4-benzoylpiperazin-1-yl)-2-(3-methylphenoxy)ethanone|1-benzoyl-4-[(3-methylphenoxy)acetyl]piperazine|1-(4-Benzoyl-piperazin-1-yl)-2-m-tolyloxy-ethanone|2-(3-methylphenoxy)-1-[4-(phenylcarbonyl)piperazin-1-yl]ethanone|1-(4-Benzoylpiperazin-1-yl)-2-(3-methylphenoxy)ethan-1-one|1-(4-BENZOYLPIPERAZINO)-2-(3-METHYLPHENOXY)-1-ETHANONE
| Molecular Formula | C20H22N2O3 |
|---|---|
| Molecular Weight | 338.16306 g/mol |
| LogP | 2.35842 |
| Topological Polar Surface Area | 49.85 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 338.16306 |
| Monoisotopic Mass | 338.16306 |
| Heavy Atoms | 25 |
| Complexity | 737.61633 |
Chemical Identifiers
| CAS Number | 423738-99-2 |
|---|---|
| SMILES | CC1=CC(=CC=C1)OCC(=O)N2CCN(CC2)C(=O)C3=CC=CC=C3 |
Product Overview
1-(4-Benzoylpiperazin-1-yl)-2-(3-methylphenoxy)ethanone (CAS 423738-99-2), with molecular formula C20H22N2O3 and molecular weight 338.16306 g/mol. IUPAC: 1-(4-benzoylpiperazin-1-yl)-2-(3-methylphenoxy)ethanone.
1-(4-Benzoylpiperazin-1-yl)-2-(3-methylphenoxy)ethanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »