Methyl Undecafluorohexanoate
methyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate
Also Known As: Methyl perfluorohexanoate|Methyl Undecafluorohexanoate|methyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate|ACMC-209jpe|MethylUndecafluorohexanoate|C5F11COOCH3|Methyl perfluoro-n-hexanoate|METHYLPERFLUOROHEXANOATE|Methyl perfluorohexanoate 250g|Undecafluorohexanoic Acid Methyl Ester|AMY6786|Perfluorohexanoic acid-methyl ester|Perfluorohexanoic Acid Methyl Ester|KS-000014AD|5849AB|K-8813|I14-61510|2-methylsulfonyl-1-[6-(trifluoromethyl)-pyridin-3-yl]ethanone|2,2,3,3,4,4,5,5,6,6,6-Undecafluoro- hexanoic acid methyl ester|2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoic acid methyl ester|methyl 2,2,3,3,4,4,5,5,6,6,6-undecakis(fluoranyl)hexanoate|Hexanoic acid,2,2,3,3,4,4,5,5,6,6,6-undecafluoro-, methyl ester|677-545-1|Methyl perfluorohexanoate; Perfluorohexanoic acid methyl ester; Undecafluorohexanoic acid methyl ester
| Molecular Formula | C7H3F11O2 |
|---|---|
| Molecular Weight | 327.99573 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 26.3 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Exact Mass | 327.99573 |
| Monoisotopic Mass | 327.99573 |
| Heavy Atoms | 20 |
| Complexity | 383.0 |
Chemical Identifiers
| CAS Number | 424-18-0 |
|---|---|
| SMILES | COC(=O)C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
| InChIKey | NJXMLQHJFDKLKL-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl Undecafluorohexanoate (CAS 424-18-0), with molecular formula C7H3F11O2 and molecular weight 327.99573 g/mol. IUPAC: methyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate.