Estradiol Acetate
[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate
Also Known As: Estradiol acetate|Femring|Femtrace|Menoring|Estradiol 3-acetate|Estradiol-3-acetate|3-O-Acetylestradiol|estradiol-acetate|Estradiol, 3-acetate|Femring (TN)|beta-Estradiol 3-acetate|17beta-Estradiol 3-acetate|Estradiol acetate [USAN]|-Estradiol 3-acetate|Estradiol Impurity 25|E 3A|Promestriene Impurity 10|Estradiol acetate (USAN)|17-beta-Estradiol-acetate|(17beta)-Estradiol 3-acetate|ERK5-2J11|ESTRADIOL ACETATE [VANDF]|ESTRADIOL 3-ACETATE [MI]|ESTRADIOL ACETATE (MART.)|ESTRADIOL ACETATE [MART.]|ESTRADIOL ACETATE [WHO-DD]|Tox21_111359|Tox21_113661|3-Acetoxyestra-1,3,5(10)-trien-17beta-ol|ESTRADIOL ACETATE [ORANGE BOOK]|NCGC00094925-01|NCGC00249885-01
| Molecular Formula | C20H26O3 |
|---|---|
| Molecular Weight | 314.1882 g/mol |
| LogP | 3.8289 |
| Topological Polar Surface Area | 46.53 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 314.1882 |
| Monoisotopic Mass | 314.1882 |
| Heavy Atoms | 23 |
| Complexity | 637.774 |
Chemical Identifiers
| CAS Number | 4245-41-4 |
|---|---|
| SMILES | CC(=O)OC1=CC2=C(C=C1)[C@H]3CC[C@]4([C@H]([C@@H]3CC2)CC[C@@H]4O)C |
Product Overview
Estradiol Acetate (CAS 4245-41-4), with molecular formula C20H26O3 and molecular weight 314.1882 g/mol. IUPAC: [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.