Xanthen-9-one, 3-(diethylamino)methyl-4-methoxy-, hydrochloride
3-(diethylaminomethyl)-4-methoxyxanthen-9-one;hydrochloride
Also Known As: 4-bromo methanesulphonanilide|3-(Diethylamino)methyl-4-methoxy-9-xanthone hydrochloride|Xanthen-9-one, 3-(diethylamino)methyl-4-methoxy-, hydrochloride|4-(Diethylamino)methyl-4-methoxyxanthen-9-one hydrochloride|3-(diethylaminomethyl)-4-methoxyxanthen-9-one,hydrochloride|3-(diethylaminomethyl)-4-methoxyxanthen-9-one hydrochloride|9H-Xanthen-9-one, 3-[(diethylamino)methyl]-4-methoxy-, hydrochloride|3-[(Diethylamino)methyl]-4-methoxy-9H-xanthen-9-one--hydrogen chloride (1/1)
| Molecular Formula | C19H22ClNO3 |
|---|---|
| Molecular Weight | 347.1288 g/mol |
| LogP | 4.2184 |
| Topological Polar Surface Area | 38.8 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 347.1288 |
| Monoisotopic Mass | 347.1288 |
| Heavy Atoms | 24 |
| Complexity | 409.0 |
Chemical Identifiers
| CAS Number | 42840-06-2 |
|---|---|
| SMILES | CCN(CC)CC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3O2)OC.Cl |
| InChIKey | FQCMNSRHNHUIHH-UHFFFAOYSA-N |
Product Overview
Xanthen-9-one, 3-(diethylamino)methyl-4-methoxy-, hydrochloride (CAS 42840-06-2), with molecular formula C19H22ClNO3 and molecular weight 347.1288 g/mol. IUPAC: 3-(diethylaminomethyl)-4-methoxyxanthen-9-one;hydrochloride.