![N-{2-[(2-chlorobenzyl)sulfanyl]ethyl}-2-(4-chlorophenoxy)acetamide structure](/static/products/4284/428475-15-4.webp)
N-{2-[(2-chlorobenzyl)sulfanyl]ethyl}-2-(4-chlorophenoxy)acetamide
2-(4-chlorophenoxy)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide
Also Known As: N-{2-[(2-chlorobenzyl)sulfanyl]ethyl}-2-(4-chlorophenoxy)acetamide|2-(4-chlorophenoxy)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide|N-{2-[(2-chlorobenzyl)thio]ethyl}-2-(4-chlorophenoxy)acetamide|2-(4-CHLOROPHENOXY)-N-(2-{[(2-CHLOROPHENYL)METHYL]SULFANYL}ETHYL)ACETAMIDE
| Molecular Formula | C17H17Cl2NO2S |
|---|---|
| Molecular Weight | 369.0357 g/mol |
| LogP | 4.4218 |
| Topological Polar Surface Area | 38.33 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Exact Mass | 369.0357 |
| Monoisotopic Mass | 369.0357 |
| Heavy Atoms | 23 |
| Complexity | 634.7454 |
Chemical Identifiers
| CAS Number | 428475-15-4 |
|---|---|
| SMILES | C1=CC=C(C(=C1)CSCCNC(=O)COC2=CC=C(C=C2)Cl)Cl |
Product Overview
N-{2-[(2-chlorobenzyl)sulfanyl]ethyl}-2-(4-chlorophenoxy)acetamide (CAS 428475-15-4), with molecular formula C17H17Cl2NO2S and molecular weight 369.0357 g/mol. IUPAC: 2-(4-chlorophenoxy)-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide.
N-{2-[(2-chlorobenzyl)sulfanyl]ethyl}-2-(4-chlorophenoxy)acetamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »