(4-Fluorophenyl)-(4-propylsulfonylpiperazin-1-yl)methanone
(4-fluorophenyl)-(4-propylsulfonylpiperazin-1-yl)methanone
Also Known As: Oprea1_146394|Oprea1_387850|BAS 03153025|(4-fluorophenyl)-(4-propylsulfonylpiperazin-1-yl)methanone|4-fluorophenyl 4-(propylsulfonyl)piperazinyl ketone|SR-01000482149-1|(4-fluorophenyl)[4-(propylsulfonyl)piperazin-1-yl]methanone|(4-FLUOROPHENYL)[4-(PROPYLSULFONYL)PIPERAZINO]METHANONE|1-(4-FLUOROBENZOYL)-4-(PROPANE-1-SULFONYL)PIPERAZINE|(4-Fluoro-phenyl)-[4-(propane-1-sulfonyl)-piperazin-1-yl]-methanone
| Molecular Formula | C14H19FN2O3S |
|---|---|
| Molecular Weight | 314.11005 g/mol |
| LogP | 1.4 |
| Topological Polar Surface Area | 66.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 314.11005 |
| Monoisotopic Mass | 314.11005 |
| Heavy Atoms | 21 |
| Complexity | 447.0 |
Chemical Identifiers
| CAS Number | 428503-93-9 |
|---|---|
| SMILES | CCCS(=O)(=O)N1CCN(CC1)C(=O)C2=CC=C(C=C2)F |
| InChIKey | GTVUUIHCEMHLBR-UHFFFAOYSA-N |
Product Overview
(4-Fluorophenyl)-(4-propylsulfonylpiperazin-1-yl)methanone (CAS 428503-93-9), with molecular formula C14H19FN2O3S and molecular weight 314.11005 g/mol. IUPAC: (4-fluorophenyl)-(4-propylsulfonylpiperazin-1-yl)methanone.
(4-Fluorophenyl)-(4-propylsulfonylpiperazin-1-yl)methanone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »