1-[(4-Methylsulfanylphenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine
1-[(4-methylsulfanylphenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine
Also Known As: Oprea1_114625|SR-01000481836-1|1-[(4-methylsulfanylphenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine|1-[4-(methylsulfanyl)benzyl]-4-(naphthalen-2-ylsulfonyl)piperazine|1-(4-(methylthio)benzyl)-4-(naphthalen-2-ylsulfonyl)piperazine|1-[(4-methylsulfanylphenyl)methyl]-4-naphthalen-2-ylsulfonyl-piperazine|1-[4-(METHYLSULFANYL)BENZYL]-4-(2-NAPHTHYLSULFONYL)PIPERAZINE
| Molecular Formula | C22H24N2O2S2 |
|---|---|
| Molecular Weight | 412.12793 g/mol |
| LogP | 4.0682 |
| Topological Polar Surface Area | 40.62 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 412.12793 |
| Monoisotopic Mass | 412.12793 |
| Heavy Atoms | 28 |
| Complexity | 1057.3468 |
Chemical Identifiers
| CAS Number | 429620-76-8 |
|---|---|
| SMILES | CSC1=CC=C(C=C1)CN2CCN(CC2)S(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Product Overview
1-[(4-Methylsulfanylphenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine (CAS 429620-76-8), with molecular formula C22H24N2O2S2 and molecular weight 412.12793 g/mol. IUPAC: 1-[(4-methylsulfanylphenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine.
1-[(4-Methylsulfanylphenyl)methyl]-4-naphthalen-2-ylsulfonylpiperazine is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »