Dimethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
dimethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Also Known As: Amlodipine EP Impurity G|dimethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate|Amlodipine besilate impurity G|Amlodipine impurity G|Calcium Channel antagonist 1|starbld0009021|Amlodipine impurity G CRS|AMLODIPINE RELATED COMPOUND C|Oprea1_397112|Oprea1_609948|Amlodipine Besylate EP Impurity G|Amlodipine USP Related Compound C|BAS 00156990|HY-W278072|AMLODIPINE RELATED COMPOUND C [USP-RS]|AMLODIPINE BESILATE IMPURITY G [EP IMPURITY]|AMLODIPINE RELATED COMPOUND C (USP-RS)
| Molecular Formula | C17H18ClNO4 |
|---|---|
| Molecular Weight | 335.09244 g/mol |
| LogP | 3.0 |
| Topological Polar Surface Area | 64.6 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Exact Mass | 335.09244 |
| Monoisotopic Mass | 335.09244 |
| Heavy Atoms | 23 |
| Complexity | 529.0 |
Chemical Identifiers
| CAS Number | 43067-01-2 |
|---|---|
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC)C2=CC=CC=C2Cl)C(=O)OC |
| InChIKey | REIGLQUFMMOAFU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Dimethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 43067-01-2), with molecular formula C17H18ClNO4 and molecular weight 335.09244 g/mol. IUPAC: dimethyl 4-(2-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.