Xanthen-9-one, 3-nitro-4-piperidinomethyl-
3-nitro-4-(piperidin-1-ylmethyl)xanthen-9-one
Also Known As: Xanthen-9-one, 3-nitro-4-piperidinomethyl-|3-Nitro-4-piperidinomethylxanthen-9-one|3-Nitro-4- -9H-xanthen-9-one|Xanthen-9-one,3-nitro-4-piperidinomethyl|3-nitro-4-(piperidin-1-ylmethyl)xanthen-9-one|3-Nitro-4-(piperidinomethyl)-9H-xanthen-9-one|3-nitro-4-(piperidin-1-ylmethyl)-9H-xanthen-9-one|3-NITRO-4-PIPERIDIN-1-YLMETHYLXANTHEN-9-ONE|9H-Xanthen-9-one, 3-nitro-4-(1-piperidinylmethyl)-|3-NITRO-4-[(PIPERIDIN-1-YL)METHYL]-9H-XANTHEN-9-ONE
| Molecular Formula | C19H18N2O4 |
|---|---|
| Molecular Weight | 338.12665 g/mol |
| LogP | 3.5 |
| Topological Polar Surface Area | 75.4 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Exact Mass | 338.12665 |
| Monoisotopic Mass | 338.12665 |
| Heavy Atoms | 25 |
| Complexity | 514.0 |
Chemical Identifiers
| CAS Number | 43159-93-9 |
|---|---|
| SMILES | C1CCN(CC1)CC2=C(C=CC3=C2OC4=CC=CC=C4C3=O)[N+](=O)[O-] |
| InChIKey | KTGCDTPTMFJEEC-UHFFFAOYSA-N |
Product Overview
Xanthen-9-one, 3-nitro-4-piperidinomethyl- (CAS 43159-93-9), with molecular formula C19H18N2O4 and molecular weight 338.12665 g/mol. IUPAC: 3-nitro-4-(piperidin-1-ylmethyl)xanthen-9-one.
Xanthen-9-one, 3-nitro-4-piperidinomethyl- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »