![N-[3-({[4-(propan-2-yl)phenyl]carbonyl}amino)phenyl]thiophene-2-carboxamide structure](/static/products/4319/431908-03-1.webp)
N-[3-({[4-(propan-2-yl)phenyl]carbonyl}amino)phenyl]thiophene-2-carboxamide
N-[3-[(4-propan-2-ylbenzoyl)amino]phenyl]thiophene-2-carboxamide
Also Known As: Oprea1_235162|BAS 03596675|AB00118284-01|N-[3-({[4-(propan-2-yl)phenyl]carbonyl}amino)phenyl]thiophene-2-carboxamide|N-[3-[(4-propan-2-ylbenzoyl)amino]phenyl]thiophene-2-carboxamide|N-(3-{[4-(methylethyl)phenyl]carbonylamino}phenyl)-2-thienylcarboxamide|Thiophene-2-carboxylic acid [3-(4-isopropyl-benzoylamino)-phenyl]-amide
| Molecular Formula | C21H20N2O2S |
|---|---|
| Molecular Weight | 364.12454 g/mol |
| LogP | 5.3761 |
| Topological Polar Surface Area | 58.2 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 364.12454 |
| Monoisotopic Mass | 364.12454 |
| Heavy Atoms | 26 |
| Complexity | 900.0252 |
Chemical Identifiers
| CAS Number | 431908-03-1 |
|---|---|
| SMILES | CC(C)C1=CC=C(C=C1)C(=O)NC2=CC(=CC=C2)NC(=O)C3=CC=CS3 |
Product Overview
N-[3-({[4-(propan-2-yl)phenyl]carbonyl}amino)phenyl]thiophene-2-carboxamide (CAS 431908-03-1), with molecular formula C21H20N2O2S and molecular weight 364.12454 g/mol. IUPAC: N-[3-[(4-propan-2-ylbenzoyl)amino]phenyl]thiophene-2-carboxamide.
N-[3-({[4-(propan-2-yl)phenyl]carbonyl}amino)phenyl]thiophene-2-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »