![N-{2-methoxy-4-[(trichloroacetyl)amino]phenyl}-1-benzofuran-2-carboxamide structure](/static/products/4319/431908-19-9.webp)
N-{2-methoxy-4-[(trichloroacetyl)amino]phenyl}-1-benzofuran-2-carboxamide
N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]-1-benzofuran-2-carboxamide
Also Known As: SR-01000242572-1|N-{2-methoxy-4-[(trichloroacetyl)amino]phenyl}-1-benzofuran-2-carboxamide|N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]-1-benzofuran-2-carboxamide|N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]benzofuran-2-carboxamide
| Molecular Formula | C18H13Cl3N2O4 |
|---|---|
| Molecular Weight | 425.99408 g/mol |
| LogP | 5.0024 |
| Topological Polar Surface Area | 80.57 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 425.99408 |
| Monoisotopic Mass | 425.99408 |
| Heavy Atoms | 27 |
| Complexity | 978.2545 |
Chemical Identifiers
| CAS Number | 431908-19-9 |
|---|---|
| SMILES | COC1=C(C=CC(=C1)NC(=O)C(Cl)(Cl)Cl)NC(=O)C2=CC3=CC=CC=C3O2 |
Product Overview
N-{2-methoxy-4-[(trichloroacetyl)amino]phenyl}-1-benzofuran-2-carboxamide (CAS 431908-19-9), with molecular formula C18H13Cl3N2O4 and molecular weight 425.99408 g/mol. IUPAC: N-[2-methoxy-4-[(2,2,2-trichloroacetyl)amino]phenyl]-1-benzofuran-2-carboxamide.
N-{2-methoxy-4-[(trichloroacetyl)amino]phenyl}-1-benzofuran-2-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »