1-Cyclopentene-1-ethanamine, alpha-ethyl-2,3,3-trimethyl-, hydrochloride
1-(2,3,3-trimethylcyclopenten-1-yl)butan-2-amine;hydrochloride
Also Known As: KST-1B4270|2-Amino-1-(2,3,3-trimethylcyclopent-1-en-1-yl)butane hydrochloride|1-(2,3,3-trimethylcyclopent-1-en-1-yl)butan-2-amine hydrochloride(1:1)|1-Cyclopentene-1-ethanamine, alpha-ethyl-2,3,3-trimethyl-, hydrochloride|alpha-Ethyl-2,3,3-trimethyl-1-cyclopentene-1-ethanamine hydrochloride|1-(2,3,3-trimethylcyclopenten-1-yl)butan-2-amine hydrochloride|1-(2,3,3-Trimethylcyclopent-1-en-1-yl)butan-2-amine--hydrogen chloride (1/1)|n-ethyl-2-(2,3,3-trimethylcyclopent-1-en-1-yl)ethanamine hydrochloride(1:1)
| Molecular Formula | C12H24ClN |
|---|---|
| Molecular Weight | 217.15973 g/mol |
| LogP | 3.6721 |
| Topological Polar Surface Area | 26.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Exact Mass | 217.15973 |
| Monoisotopic Mass | 217.15973 |
| Heavy Atoms | 14 |
| Complexity | 213.0 |
Chemical Identifiers
| CAS Number | 433-85-2 |
|---|---|
| SMILES | CCC(CC1=C(C(CC1)(C)C)C)N.Cl |
| InChIKey | ZKFNJQSFMXCIHW-UHFFFAOYSA-N |
Product Overview
1-Cyclopentene-1-ethanamine, alpha-ethyl-2,3,3-trimethyl-, hydrochloride (CAS 433-85-2), with molecular formula C12H24ClN and molecular weight 217.15973 g/mol. IUPAC: 1-(2,3,3-trimethylcyclopenten-1-yl)butan-2-amine;hydrochloride.