3-({[(4-Fluorophenyl)carbonyl]carbamothioyl}amino)-4-methylbenzoic acid
3-[(4-fluorobenzoyl)carbamothioylamino]-4-methylbenzoic acid
Also Known As: Oprea1_424583|3-[3-(4-Fluoro-benzoyl)-thioureido]-4-methyl-benzoic acid|3-[(4-fluorobenzoyl)carbamothioylamino]-4-methylbenzoic acid|3-[(4-fluorobenzoyl)thiocarbamoylamino]-4-methyl-benzoic Acid|3-({[(4-fluorobenzoyl)amino]carbonothioyl}amino)-4-methylbenzoic acid|3-({[(4-fluorophenyl)carbonyl]carbamothioyl}amino)-4-methylbenzoic acid
| Molecular Formula | C16H13FN2O3S |
|---|---|
| Molecular Weight | 332.06308 g/mol |
| LogP | 2.95912 |
| Topological Polar Surface Area | 78.43 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 332.06308 |
| Monoisotopic Mass | 332.06308 |
| Heavy Atoms | 23 |
| Complexity | 775.39484 |
Chemical Identifiers
| CAS Number | 433694-37-2 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=S)NC(=O)C2=CC=C(C=C2)F |
Product Overview
3-({[(4-Fluorophenyl)carbonyl]carbamothioyl}amino)-4-methylbenzoic acid (CAS 433694-37-2), with molecular formula C16H13FN2O3S and molecular weight 332.06308 g/mol. IUPAC: 3-[(4-fluorobenzoyl)carbamothioylamino]-4-methylbenzoic acid.
3-({[(4-Fluorophenyl)carbonyl]carbamothioyl}amino)-4-methylbenzoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »