Cyclopentanecarboxylic acid, 1-phenyl-, 2-(dimethylamino)ethyl ester
2-(dimethylamino)ethyl 1-phenylcyclopentane-1-carboxylate
Also Known As: 2-furilmonoxime|ChemDiv3_014874|Oprea1_706357|Oprea1_720989|2-(dimethylamino)ethyl 1-phenylcyclopentane-1-carboxylate|Cyclopentanecarboxylic acid, 1-phenyl-, 2-(dimethylamino)ethyl ester|NCGC00245614-01|NCGC00245614-02|2-(dimethylamino)ethyl 1-phenylcyclopentanecarboxylate|4-09-00-02112 (Beilstein Handbook Reference)|1-Phenylcyclopentanecarboxylic acid 2-(dimethylamino)ethyl ester|2-(Dimethylamino)ethyl=1-phenylcyclopentane-1-carboxylate|AB00101490-01|AB00101490-11|AJ-292/12784039|2-Dimethylaminoethyl 1-phenylcyclopentane-1-carboxylate
| Molecular Formula | C16H23NO2 |
|---|---|
| Molecular Weight | 261.17288 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 29.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Exact Mass | 261.17288 |
| Monoisotopic Mass | 261.17288 |
| Heavy Atoms | 19 |
| Complexity | 289.0 |
Chemical Identifiers
| CAS Number | 4339-96-2 |
|---|---|
| SMILES | CN(C)CCOC(=O)C1(CCCC1)C2=CC=CC=C2 |
| InChIKey | VZAZOXVEMAUMLH-UHFFFAOYSA-N |
Product Overview
Cyclopentanecarboxylic acid, 1-phenyl-, 2-(dimethylamino)ethyl ester (CAS 4339-96-2), with molecular formula C16H23NO2 and molecular weight 261.17288 g/mol. IUPAC: 2-(dimethylamino)ethyl 1-phenylcyclopentane-1-carboxylate.