![2-({[(4-Ethoxy-3-nitrophenyl)carbonyl]carbamothioyl}amino)benzoic acid structure](/static/products/4339/433971-97-2.webp)
2-({[(4-Ethoxy-3-nitrophenyl)carbonyl]carbamothioyl}amino)benzoic acid
2-[(4-ethoxy-3-nitrobenzoyl)carbamothioylamino]benzoic acid
Also Known As: Oprea1_619743|SR-01000248353-1|2-(3-(4-ethoxy-3-nitrobenzoyl)thioureido)benzoic acid|2-[(4-ethoxy-3-nitrobenzoyl)carbamothioylamino]benzoic acid|2-({[(4-ethoxy-3-nitrophenyl)carbonyl]carbamothioyl}amino)benzoic acid|2-[(4-ethoxy-3-nitro-benzoyl)thiocarbamoylamino]benzoic Acid
| Molecular Formula | C17H15N3O6S |
|---|---|
| Molecular Weight | 389.06815 g/mol |
| LogP | 2.8185 |
| Topological Polar Surface Area | 130.8 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Exact Mass | 389.06815 |
| Monoisotopic Mass | 389.06815 |
| Heavy Atoms | 27 |
| Complexity | 915.2918 |
Chemical Identifiers
| CAS Number | 433971-97-2 |
|---|---|
| SMILES | CCOC1=C(C=C(C=C1)C(=O)NC(=S)NC2=CC=CC=C2C(=O)O)[N+](=O)[O-] |
Product Overview
2-({[(4-Ethoxy-3-nitrophenyl)carbonyl]carbamothioyl}amino)benzoic acid (CAS 433971-97-2), with molecular formula C17H15N3O6S and molecular weight 389.06815 g/mol. IUPAC: 2-[(4-ethoxy-3-nitrobenzoyl)carbamothioylamino]benzoic acid.
2-({[(4-Ethoxy-3-nitrophenyl)carbonyl]carbamothioyl}amino)benzoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »