4-Methyl-3-nitrobenzyl alcohol
(4-methyl-3-nitrophenyl)methanol
Also Known As: 4-Methyl-3-nitrobenzyl alcohol|(4-Methyl-3-nitrophenyl)methanol|4-Methyl-3-nitrobenzenemethanol|Benzenemethanol, 4-methyl-3-nitro-|3-nitro-4-methylbenzyl alcohol|4-Methyl-3-nitro benzylalcohol|Benzenemethanol,4-methyl-3-nitro-|(4-Methyl-3-nitro-phenyl)-methanol|Benzenemethanol,4-methyl-3-nitro|KST-1A4837|(4-methyl-3-nitro-phenyl)methanol|Benzyl alcohol, 4-methyl-3-nitro-|(4-Methyl-3-nitrophenyl)methanol #|CN-069|4-Methyl-3-nitrobenzyl alcohol, 99%|s10877
| Molecular Formula | C8H9NO3 |
|---|---|
| Molecular Weight | 167.05824 g/mol |
| LogP | 1.2 |
| Topological Polar Surface Area | 66.1 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Exact Mass | 167.05824 |
| Monoisotopic Mass | 167.05824 |
| Heavy Atoms | 12 |
| Complexity | 166.0 |
Chemical Identifiers
| CAS Number | 4342-49-8 |
|---|---|
| SMILES | CC1=C(C=C(C=C1)CO)[N+](=O)[O-] |
| InChIKey | URCWIFSXDARYLY-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4-Methyl-3-nitrobenzyl alcohol (CAS 4342-49-8), with molecular formula C8H9NO3 and molecular weight 167.05824 g/mol. IUPAC: (4-methyl-3-nitrophenyl)methanol.