Piperazine, 1-((2-(phenylthio)phenyl)methyl)-, monomethanesulfonate
methanesulfonic acid;1-[(2-phenylsulfanylphenyl)methyl]piperazine
Also Known As: 1-(2-Phenylthiobenzyl)piperazine mesylate|KST-1B4275|1-(2-Phenylthiobenzyl)piperazine methanesulfonate|1-((2-(Phenylthio)phenyl)methyl)piperazine methanesulfonate|1-[2-(phenylsulfanyl)benzyl]piperazine methanesulfonate(1:1)|Piperazine, 1-((2-(phenylthio)phenyl)methyl)-, monomethanesulfonate|methanesulfonic acid,1-[(2-phenylsulfanylphenyl)methyl]piperazine|methanesulfonic acid; 1-[(2-phenylsulfanylphenyl)methyl]piperazine|Methanesulfonic acid--1-{[2-(phenylsulfanyl)phenyl]methyl}piperazine (1/1)
| Molecular Formula | C18H24N2O3S2 |
|---|---|
| Molecular Weight | 380.12283 g/mol |
| LogP | 2.747 |
| Topological Polar Surface Area | 103.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Exact Mass | 380.12283 |
| Monoisotopic Mass | 380.12283 |
| Heavy Atoms | 25 |
| Complexity | 365.0 |
Chemical Identifiers
| CAS Number | 4354-85-2 |
|---|---|
| SMILES | CS(=O)(=O)O.C1CN(CCN1)CC2=CC=CC=C2SC3=CC=CC=C3 |
| InChIKey | BQDPGEPRIYPACS-UHFFFAOYSA-N |
Product Overview
Piperazine, 1-((2-(phenylthio)phenyl)methyl)-, monomethanesulfonate (CAS 4354-85-2), with molecular formula C18H24N2O3S2 and molecular weight 380.12283 g/mol. IUPAC: methanesulfonic acid;1-[(2-phenylsulfanylphenyl)methyl]piperazine.