(6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol
(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanol
Also Known As: Calycotomine|(+)-Calycotomine|(6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol|CALYCOTOMINE, 98|CALYCOTOMINE,98|(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanol|AA277|J2.573.451C|(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolyl)methan-1-ol|(6,7-Dimethoxy-1,2,3,4-tetrahydro-1-isoquinolinyl)methanol #|(6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)methanol|1-(Hydroxymethyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline|(6,7-dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol, AldrichCPR
| Molecular Formula | C12H17NO3 |
|---|---|
| Molecular Weight | 223.12085 g/mol |
| LogP | 0.6 |
| Topological Polar Surface Area | 50.7 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Exact Mass | 223.12085 |
| Monoisotopic Mass | 223.12085 |
| Heavy Atoms | 16 |
| Complexity | 224.0 |
Chemical Identifiers
| CAS Number | 4356-47-2 |
|---|---|
| SMILES | COC1=C(C=C2C(NCCC2=C1)CO)OC |
| InChIKey | JVLGDDNDVOSMSI-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
(6,7-Dimethoxy-1,2,3,4-tetrahydro-isoquinolin-1-yl)-methanol (CAS 4356-47-2), with molecular formula C12H17NO3 and molecular weight 223.12085 g/mol. IUPAC: (6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methanol.