5-Etienic acid
(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid
Also Known As: 5-Etienic acid|5-Androstene-17beta-carboxylic acid|Androst-5-ene-17-carboxylic acid|5-androstene-17 beta-carboxylic acid|Androst-5-ene-17beta-carboxylic acid|Androst-5-ene-17-carboxylic acid, (17beta)-|Androst-5-ene-17-carboxylicacid, (17b)- (9CI)|(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid
| Molecular Formula | C20H30O2 |
|---|---|
| Molecular Weight | 302.22458 g/mol |
| LogP | 5.0401 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Exact Mass | 302.22458 |
| Monoisotopic Mass | 302.22458 |
| Heavy Atoms | 22 |
| Complexity | 521.8003 |
Chemical Identifiers
| CAS Number | 438-10-8 |
|---|---|
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)O)CC=C4[C@@]3(CCCC4)C |
Product Overview
5-Etienic acid (CAS 438-10-8), with molecular formula C20H30O2 and molecular weight 302.22458 g/mol. IUPAC: (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid.