AC1LX7BP
2-(5-methylfuran-2-yl)-N-[5-methyl-4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]quinoline-4-carboxamide
Also Known As: AK-968/41170825|2-(5-methylfuran-2-yl)-N-[5-methyl-4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]quinoline-4-carboxamide|N-[4-(4-isobutylphenyl)-5-methyl-1,3-thiazol-2-yl]-2-(5-methyl-2-furyl)-4-quinolinecarboxamide|[2-(5-methyl(2-furyl))(4-quinolyl)]-N-{5-methyl-4-[4-(2-methylpropyl)phenyl](1 ,3-thiazol-2-yl)}carboxamide|2-(5-methylfuran-2-yl)-N-{5-methyl-4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl}quinoline-4-carboxamide
| Molecular Formula | C29H27N3O2S |
|---|---|
| Molecular Weight | 481.1824 g/mol |
| LogP | 7.68594 |
| Topological Polar Surface Area | 68.02 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Exact Mass | 481.1824 |
| Monoisotopic Mass | 481.1824 |
| Heavy Atoms | 35 |
| Complexity | 1513.0298 |
Chemical Identifiers
| CAS Number | 438223-75-7 |
|---|---|
| SMILES | CC1=CC=C(O1)C2=NC3=CC=CC=C3C(=C2)C(=O)NC4=NC(=C(S4)C)C5=CC=C(C=C5)CC(C)C |
Product Overview
AC1LX7BP (CAS 438223-75-7), with molecular formula C29H27N3O2S and molecular weight 481.1824 g/mol. IUPAC: 2-(5-methylfuran-2-yl)-N-[5-methyl-4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-2-yl]quinoline-4-carboxamide.