4',4'''-Bipropiophenone
1-[4-(4-propanoylphenyl)phenyl]propan-1-one
Also Known As: 4,4'-Dipropanoylbiphenyl|4',4'''-Bipropiophenone|4,4 -Dipropanoylbiphenyl|4,4 -Di(ethylcarbonyl)biphenyl|1-[4-(4-propanoylphenyl)phenyl]propan-1-one|4 ,4 -Bi[propiophenone]|J2.467.651J|1-(4'-Propionyl-biphenyl-4-yl)-propan-1-one|1,1 -(4,4 -Biphenylylene)bis(1-propanone)|1,1 -(Biphenyl-4,4 -diyl)bis(1-propanone)|1,1'-([1,1'-Biphenyl]-4,4'-diyl)di(propan-1-one)|1-{4'-propanoyl-[1,1'-biphenyl]-4-yl}propan-1-one|1,1 -(1,1 -Biphenyl-4,4 -diyl)bis(1-propanone)
| Molecular Formula | C18H18O2 |
|---|---|
| Molecular Weight | 266.13068 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 34.1 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 266.13068 |
| Monoisotopic Mass | 266.13068 |
| Heavy Atoms | 20 |
| Complexity | 297.0 |
Chemical Identifiers
| CAS Number | 4392-77-2 |
|---|---|
| SMILES | CCC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CC |
| InChIKey | YJIMYKDSJGRKAL-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4',4'''-Bipropiophenone (CAS 4392-77-2), with molecular formula C18H18O2 and molecular weight 266.13068 g/mol. IUPAC: 1-[4-(4-propanoylphenyl)phenyl]propan-1-one.