2,2'-(Cyclohexylazanediyl)bis{N-[3-(trifluoromethyl)phenyl]acetamide}
2-[cyclohexyl-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]-N-[3-(trifluoromethyl)phenyl]acetamide
Also Known As: ASN 00758978|2,2'-(Cyclohexylazanediyl)bis{N-[3-(trifluoromethyl)phenyl]acetamide}|Acetamide, 2,2'-(cyclohexylimino)bis[N-[3-(trifluoromethyl)phenyl]-|Acetamide, 2,2a(2)-(cyclohexylimino)bis[N-[3-(trifluoromethyl)phenyl]-|2-[cyclohexyl-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]-N-[3-(trifluoromethyl)phenyl]acetamide
| Molecular Formula | C24H25F6N3O2 |
|---|---|
| Molecular Weight | 501.1851 g/mol |
| LogP | 5.9361 |
| Topological Polar Surface Area | 61.44 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Exact Mass | 501.1851 |
| Monoisotopic Mass | 501.1851 |
| Heavy Atoms | 35 |
| Complexity | 958.9049 |
Chemical Identifiers
| CAS Number | 444151-97-7 |
|---|---|
| SMILES | C1CCC(CC1)N(CC(=O)NC2=CC=CC(=C2)C(F)(F)F)CC(=O)NC3=CC=CC(=C3)C(F)(F)F |
Product Overview
2,2'-(Cyclohexylazanediyl)bis{N-[3-(trifluoromethyl)phenyl]acetamide} (CAS 444151-97-7), with molecular formula C24H25F6N3O2 and molecular weight 501.1851 g/mol. IUPAC: 2-[cyclohexyl-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]amino]-N-[3-(trifluoromethyl)phenyl]acetamide.
2,2'-(Cyclohexylazanediyl)bis{N-[3-(trifluoromethyl)phenyl]acetamide} is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »