![2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]furan-3-carboxamide structure](/static/products/4450/445008-03-7.webp)
2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]furan-3-carboxamide
2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]furan-3-carboxamide
Also Known As: 2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]furan-3-carboxamide|F3088-1660|2,5-dimethyl-N-(3-(trifluoromethyl)phenyl)furan-3-carboxamide|AK-968/40709105|N-m-(trifluoromethyl)phenyl-2,5-dimethyl-3-furamide|2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]-3-furamide|(2,5-dimethyl(3-furyl))-N-[3-(trifluoromethyl)phenyl]carboxamide
| Molecular Formula | C14H12F3NO2 |
|---|---|
| Molecular Weight | 283.082 g/mol |
| LogP | 4.16754 |
| Topological Polar Surface Area | 42.24 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Exact Mass | 283.082 |
| Monoisotopic Mass | 283.082 |
| Heavy Atoms | 20 |
| Complexity | 644.1088 |
Chemical Identifiers
| CAS Number | 445008-03-7 |
|---|---|
| SMILES | CC1=CC(=C(O1)C)C(=O)NC2=CC=CC(=C2)C(F)(F)F |
Product Overview
2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]furan-3-carboxamide (CAS 445008-03-7), with molecular formula C14H12F3NO2 and molecular weight 283.082 g/mol. IUPAC: 2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]furan-3-carboxamide.
2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]furan-3-carboxamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »