AC1MKC1C
4-amino-6-(3,4-difluorophenyl)-11,13-dimethyl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-5-carbonitrile
Also Known As: BAS 06900583|2-amino-4-(3,4-difluorophenyl)-7,9-dimethyl-4H-pyrano[2',3':4,5]thieno[2,3-b]pyridine-3-carbonitrile|AM-807/14146392|2-amino-4-(3,4-difluorophenyl)-7,9-dimethyl-4H-pyrano[3,4]thieno[1,3-b]pyridine-3-carbonitrile|4-amino-6-(3,4-difluorophenyl)-11,13-dimethyl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-5-carbonitrile
| Molecular Formula | C19H13F2N3OS |
|---|---|
| Molecular Weight | 369.07474 g/mol |
| LogP | 4.40952 |
| Topological Polar Surface Area | 71.93 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Exact Mass | 369.07474 |
| Monoisotopic Mass | 369.07474 |
| Heavy Atoms | 26 |
| Complexity | 1143.8722 |
Chemical Identifiers
| CAS Number | 445382-33-2 |
|---|---|
| SMILES | CC1=CC(=NC2=C1C3=C(S2)C(C(=C(O3)N)C#N)C4=CC(=C(C=C4)F)F)C |
Product Overview
AC1MKC1C (CAS 445382-33-2), with molecular formula C19H13F2N3OS and molecular weight 369.07474 g/mol. IUPAC: 4-amino-6-(3,4-difluorophenyl)-11,13-dimethyl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-5-carbonitrile.