![4-({5-[6-(Benzylsulfanyl)-9h-purin-9-yl]pentanoyl}amino)-2-hydroxybenzoic acid structure](/static/products/4472/4472-02-0.webp)
4-({5-[6-(Benzylsulfanyl)-9h-purin-9-yl]pentanoyl}amino)-2-hydroxybenzoic acid
4-[5-(6-benzylsulfanylpurin-9-yl)pentanoylamino]-2-hydroxybenzoic acid
Also Known As: 4-({5-[6-(benzylsulfanyl)-9h-purin-9-yl]pentanoyl}amino)-2-hydroxybenzoic acid|4-[5-(6-benzylsulfanylpurin-9-yl)pentanoylamino]-2-hydroxybenzoic acid|4-(5-(6-(Benzylthio)-9H-purin-9-yl)pentanamido)-2-hydroxybenzoic acid|4-{5-[6-(Benzylsulfanyl)-9H-purin-9-yl]pentanamido}-2-hydroxybenzoic acid
| Molecular Formula | C24H23N5O4S |
|---|---|
| Molecular Weight | 477.14706 g/mol |
| LogP | 3.6 |
| Topological Polar Surface Area | 156.0 Ų |
| Hydrogen Bond Donors | 3 |
| Hydrogen Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Exact Mass | 477.14706 |
| Monoisotopic Mass | 477.14706 |
| Heavy Atoms | 34 |
| Complexity | 680.0 |
Chemical Identifiers
| CAS Number | 4472-02-0 |
|---|---|
| SMILES | C1=CC=C(C=C1)CSC2=NC=NC3=C2N=CN3CCCCC(=O)NC4=CC(=C(C=C4)C(=O)O)O |
| InChIKey | ZKNYGLOBXFZJHA-UHFFFAOYSA-N |
Product Overview
4-({5-[6-(Benzylsulfanyl)-9h-purin-9-yl]pentanoyl}amino)-2-hydroxybenzoic acid (CAS 4472-02-0), with molecular formula C24H23N5O4S and molecular weight 477.14706 g/mol. IUPAC: 4-[5-(6-benzylsulfanylpurin-9-yl)pentanoylamino]-2-hydroxybenzoic acid.
4-({5-[6-(Benzylsulfanyl)-9h-purin-9-yl]pentanoyl}amino)-2-hydroxybenzoic acid is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »