2-(Thiophen-2-ylmethyl)propanedioic acid
2-(thiophen-2-ylmethyl)propanedioic acid
Also Known As: Eprosartan related coMpound C|2-(thiophen-2-ylmethyl)propanedioic acid|Eprosartan USP Rc C|2-(Thiophen-2-ylmethyl)malonic acid|2-(2-thienylmethyl)malonic acid|NCIStruc1_000129|NCIStruc2_000283|thien-2-ylmethyl-malonic acid|2-[(thiophen-2-yl)methyl]propanedioic acid|(thiophen-2-ylmethyl)propanedioic acid|KST-1A5715|2-(thiophen-2-ylmethyl)propanedioicacid|NCGC00013456-02|NCGC00096571-01|[(Thiophen-2-yl)methyl]propanedioic acid|NCI60_003705|(2-Thenyl)malonic acid, 2-(2-Thienylmethyl)propanedioic acid, 2-(Thiophen-2-ylmethyl)malonic acid|Propanedioic acid, 2-(2-thienylmethyl)-; Malonic acid, (2-thenyl)- (8CI); Propanedioic acid, (2-thienylmethyl)- (9CI); (2-Thiophenemethyl)malonic acid; 2-[(Thiophen-2-yl)methyl]malonic acid; NSC 39209; Eprosartan Related Compound C
| Molecular Formula | C8H8O4S |
|---|---|
| Molecular Weight | 200.01433 g/mol |
| LogP | 1.2 |
| Topological Polar Surface Area | 103.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Exact Mass | 200.01433 |
| Monoisotopic Mass | 200.01433 |
| Heavy Atoms | 13 |
| Complexity | 202.0 |
Chemical Identifiers
| CAS Number | 4475-24-5 |
|---|---|
| SMILES | C1=CSC(=C1)CC(C(=O)O)C(=O)O |
| InChIKey | PGGOEUVKDHKGKQ-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 3 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
2-(Thiophen-2-ylmethyl)propanedioic acid (CAS 4475-24-5), with molecular formula C8H8O4S and molecular weight 200.01433 g/mol. IUPAC: 2-(thiophen-2-ylmethyl)propanedioic acid.