4'-Fluoro-2'-nitroacetanilide
N-(4-fluoro-2-nitrophenyl)acetamide
Also Known As: 4'-Fluoro-2'-nitroacetanilide|N-(4-Fluoro-2-nitrophenyl)acetamide|4-Fluoro-2-nitroacetanilide|Maybridge1_003501|ACMC-209k01|HMS551H03|4/'-Fluoro-2/'-nitroacetanilide|KS-000015DF|6185AB|LABOTEST-BB LT00455473|LABOTEST-BB LT03332301|4 -Fluoro-2 -nitroacetanilide|4//'-Fluoro-2//'-nitroacetanilide|N-(2-Nitro-4-fluorophenyl)acetamide|2 -Nitro-4 -fluoroacetoanilide|N-(4-fluoro-2-nitro-phenyl)acetamide|FS-4140|SDCCGSBI-0661206.P001|Acetamide,N-(4-fluoro-2-nitrophenyl)-|N-(4-fluoro-2-nitro-phenyl)-acetamide|N-(4-Fluoro-2-nitrophenyl)acetamide #|4-(4-methylpiperazin-1-yl)benzoic acid
| Molecular Formula | C8H7FN2O3 |
|---|---|
| Molecular Weight | 198.04407 g/mol |
| LogP | 1.3 |
| Topological Polar Surface Area | 74.9 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 198.04407 |
| Monoisotopic Mass | 198.04407 |
| Heavy Atoms | 14 |
| Complexity | 241.0 |
Chemical Identifiers
| CAS Number | 448-39-5 |
|---|---|
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)[N+](=O)[O-] |
| InChIKey | UZBZEUCQENVPQB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
4'-Fluoro-2'-nitroacetanilide (CAS 448-39-5), with molecular formula C8H7FN2O3 and molecular weight 198.04407 g/mol. IUPAC: N-(4-fluoro-2-nitrophenyl)acetamide.