4,4''-Difluoro-5'-(4-fluorophenyl)-1,1':3',1''-terphenyl
1,3,5-tris(4-fluorophenyl)benzene
Also Known As: 1,3,5-tris(4-fluorophenyl)benzene|4,4''-Difluoro-5'-(4-fluorophenyl)-1,1':3',1''-terphenyl|1,3,5-Tri(4-fluorophenyl)benzene|YSZC2645|1,3,5-tris(4'-fluorophenyl)benzene|J2.401.642K|C-0065|4'-FLUORO-3,5-BIS(4-FLUOROPHENYL)-1,1'-BIPHENYL|1 pound not3 pound not5-tris(4-fluorophenyl)benzene|1~4~,3~4~-Difluoro-2~5~-(4-fluorophenyl)-1~1~,2~1~:2~3~,3~1~-terphenyl|4,4 inverted exclamation mark inverted exclamation mark -Difluoro-5 inverted exclamation mark -(4-fluorophenyl)-1,1 inverted exclamation mark :3 inverted exclamation mark ,1 inverted exclamation mark inverted exclamation mark -terphenyl
| Molecular Formula | C24H15F3 |
|---|---|
| Molecular Weight | 360.11258 g/mol |
| LogP | 7.1 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 360.11258 |
| Monoisotopic Mass | 360.11258 |
| Heavy Atoms | 27 |
| Complexity | 364.0 |
Chemical Identifiers
| CAS Number | 448-60-2 |
|---|---|
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)F |
| InChIKey | VEFYJLJMXLVIOZ-UHFFFAOYSA-N |
Product Overview
4,4''-Difluoro-5'-(4-fluorophenyl)-1,1':3',1''-terphenyl (CAS 448-60-2), with molecular formula C24H15F3 and molecular weight 360.11258 g/mol. IUPAC: 1,3,5-tris(4-fluorophenyl)benzene.