3,3'-Difluorobenzidine
4-(4-amino-3-fluorophenyl)-2-fluoroaniline
Also Known As: 3,3'-Difluorobenzidine|3,3'-Difluoro-[1,1'-biphenyl]-4,4'-diamine|F2Bz|4,4'-DIAMINO-3,3'-DIFLUOROBIPHENYL|ACMC-1AI1L|Benzidine, 3,3'-difluoro-|4-(4-amino-3-fluorophenyl)-2-fluoroaniline|3,3 -Difluorobenzidine|3,3'-Difluorobiphenyl-4,4'-diamine|3,3'-Difluoro-(1,1'-biphenyl)-4,4'-diamine|3,3 -Difluoro-4,4 -diaminobiphenyl|4-13-00-00383 (Beilstein Handbook Reference)|(1,1'-Biphenyl)-4,4'-diamine, 3,3'-difluoro-|[1,1'-Biphenyl]-4,4'-diamine, 3,3'-difluoro-|3,3'-Difluoro[1,1'-biphenyl]-4,4'-diamine|4-(4-amino-3-fluoro-phenyl)-2-fluoro-aniline|B-2663|[1,1'-Biphenyl]-4,4'-diamine,3,3'-difluoro-|3,3''-Difluoro-[1,1''-biphenyl]-4,4''-diamine
| Molecular Formula | C12H10F2N2 |
|---|---|
| Molecular Weight | 220.0812 g/mol |
| LogP | 2.5 |
| Topological Polar Surface Area | 52.0 Ų |
| Hydrogen Bond Donors | 2 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Exact Mass | 220.0812 |
| Monoisotopic Mass | 220.0812 |
| Heavy Atoms | 16 |
| Complexity | 213.0 |
Chemical Identifiers
| CAS Number | 448-97-5 |
|---|---|
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)N)F)F)N |
| InChIKey | LVNPGQZSPDFZNC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 8 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
3,3'-Difluorobenzidine (CAS 448-97-5), with molecular formula C12H10F2N2 and molecular weight 220.0812 g/mol. IUPAC: 4-(4-amino-3-fluorophenyl)-2-fluoroaniline.