![N-{4-[(difluoromethyl)sulfanyl]phenyl}-2-phenylacetamide structure](/static/products/4481/448199-08-4.webp)
N-{4-[(difluoromethyl)sulfanyl]phenyl}-2-phenylacetamide
N-[4-(difluoromethylsulfanyl)phenyl]-2-phenylacetamide
Also Known As: N-{4-[(difluoromethyl)sulfanyl]phenyl}-2-phenylacetamide|N-[4-[(Difluoromethyl)thio]phenyl]benzeneacetamide|N-[4-(difluoromethylsulfanyl)phenyl]-2-phenylacetamide|N-p-(difluoromethylthio)phenylphenylacetamide|N-[4-(difluoromethylthio)phenyl]-2-phenylacetamide|VU0256234-2|VU0256234-3|F3115-0107|AF-399/15392007|Benzeneacetamide, N-[4-[(difluoromethyl)thio]phenyl]-|N-(4-((difluoromethyl)thio)phenyl)-2-phenylacetamide
| Molecular Formula | C15H13F2NOS |
|---|---|
| Molecular Weight | 293.0686 g/mol |
| LogP | 4.5 |
| Topological Polar Surface Area | 54.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Exact Mass | 293.0686 |
| Monoisotopic Mass | 293.0686 |
| Heavy Atoms | 20 |
| Complexity | 300.0 |
Chemical Identifiers
| CAS Number | 448199-08-4 |
|---|---|
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=CC=C(C=C2)SC(F)F |
| InChIKey | KYTIPFIEVHQPMK-UHFFFAOYSA-N |
Product Overview
N-{4-[(difluoromethyl)sulfanyl]phenyl}-2-phenylacetamide (CAS 448199-08-4), with molecular formula C15H13F2NOS and molecular weight 293.0686 g/mol. IUPAC: N-[4-(difluoromethylsulfanyl)phenyl]-2-phenylacetamide.
N-{4-[(difluoromethyl)sulfanyl]phenyl}-2-phenylacetamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »