Benzene, 1,1'-(chloroethenylidene)bis-
(2-chloro-1-phenylethenyl)benzene
Also Known As: Diphenylchloraethylen|(2-chloro-1-phenylethenyl)benzene|1,1-Diphenyl-2-chloroethene|1-Chloro-2,2-diphenylethene|2,2-Diphenylvinyl chloride|Benzene, 1,1'-(chloroethenylidene)bis-|Ethylene, 2-chloro-1,1-diphenyl-|1,1-Diphenyl-2-chloroethylene|2-Chloro-1,1-diphenylethylene|(2-Chloro-1-phenylvinyl)benzene|(2-Chloro-1-phenylvinyl)benzene #|(2-chloroethene-1,1-diyl)dibenzene|1,1 -(Chloroethenylidene)bisbenzene|1,1'-(2-Chloroethene-1,1-diyl)dibenzene
| Molecular Formula | C14H11Cl |
|---|---|
| Molecular Weight | 214.05493 g/mol |
| LogP | 4.9 |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 0 |
| Rotatable Bonds | 2 |
| Exact Mass | 214.05493 |
| Monoisotopic Mass | 214.05493 |
| Heavy Atoms | 15 |
| Complexity | 187.0 |
Chemical Identifiers
| CAS Number | 4541-89-3 |
|---|---|
| SMILES | C1=CC=C(C=C1)C(=CCl)C2=CC=CC=C2 |
| InChIKey | DLIRODSKOPSWFS-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Benzene, 1,1'-(chloroethenylidene)bis- (CAS 4541-89-3), with molecular formula C14H11Cl and molecular weight 214.05493 g/mol. IUPAC: (2-chloro-1-phenylethenyl)benzene.