Methyl 2-phenyl-4-quinolinecarboxylate
methyl 2-phenylquinoline-4-carboxylate
Also Known As: methyl 2-phenylquinoline-4-carboxylate|Methyl 2-phenyl-4-quinolinecarboxylate|Cinchophen methyl derivative|Oprea1_635797|methyl2-phenylquinoline-4-carboxylate|2-Phenyl-quinoline-4-carboxylic acid methyl ester|methyl-2-phenyl-4-quinolinecarboxylate|2,3,9,10-TETRAMETHYLANTRACENE|NCGC00297127-01|2-phenylquinoline-4-carboxylic acid methyl ester|4-Quinolinecarboxylic acid, 2-phenyl-, methyl ester|J1.255.819H|Methyl 2-phenyl-4-quinolinecarboxylate, 95%|AB00309171-03|AK-968/41008459|I04-9121|SR-01000254417-1|2-PHENYL-QUINOLINE-4-CARBOXYLICACIDMETHYLESTER
| Molecular Formula | C17H13NO2 |
|---|---|
| Molecular Weight | 263.09464 g/mol |
| LogP | 3.7 |
| Topological Polar Surface Area | 39.2 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Exact Mass | 263.09464 |
| Monoisotopic Mass | 263.09464 |
| Heavy Atoms | 20 |
| Complexity | 338.0 |
Chemical Identifiers
| CAS Number | 4546-48-9 |
|---|---|
| SMILES | COC(=O)C1=CC(=NC2=CC=CC=C21)C3=CC=CC=C3 |
| InChIKey | FDNMMBMNYRTPLC-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 4 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Methyl 2-phenyl-4-quinolinecarboxylate (CAS 4546-48-9), with molecular formula C17H13NO2 and molecular weight 263.09464 g/mol. IUPAC: methyl 2-phenylquinoline-4-carboxylate.