3,7-Dibromo-4-isopropyltropolone
2,6-dibromo-7-hydroxy-3-propan-2-ylcyclohepta-2,4,6-trien-1-one
Also Known As: 3,7-Dibromo-4-isopropyltropolone|J1.399.811F|3,7-dibromo-2-hydroxy-4-(propan-2-yl)cyclohepta-2,4,6-trien-1-one|2,6-dibromo-7-hydroxy-3-propan-2-ylcyclohepta-2,4,6-trien-1-one|3,7-Dibromo-2-hydroxy-4-isopropyl-2,4,6-cycloheptatrien-1-one #|3,7-Dibromo-2-hydroxy-4-isopropyl-2,4,6-cycloheptatriene-1-one|3,7-dibromo-2-hydroxy-6-isopropyl-2,4,6-cycloheptatrien-1-one|3,7-Dibromo-2-hydroxy-4-(1-methylethyl)-2,4,6-cycloheptatrien-1-one
| Molecular Formula | C10H10Br2O2 |
|---|---|
| Molecular Weight | 319.90475 g/mol |
| LogP | 3.4 |
| Topological Polar Surface Area | 37.3 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Exact Mass | 319.90475 |
| Monoisotopic Mass | 319.90475 |
| Heavy Atoms | 14 |
| Complexity | 362.0 |
Chemical Identifiers
| CAS Number | 4584-66-1 |
|---|---|
| SMILES | CC(C)C1=C(C(=O)C(=C(C=C1)Br)O)Br |
| InChIKey | FEHMNUNVDNGBFI-UHFFFAOYSA-N |
Product Overview
3,7-Dibromo-4-isopropyltropolone (CAS 4584-66-1), with molecular formula C10H10Br2O2 and molecular weight 319.90475 g/mol. IUPAC: 2,6-dibromo-7-hydroxy-3-propan-2-ylcyclohepta-2,4,6-trien-1-one.
3,7-Dibromo-4-isopropyltropolone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »