Cyclohexanone, 2-(2-nitro-1-phenylethyl)-
2-(2-nitro-1-phenylethyl)cyclohexan-1-one
Also Known As: Oprea1_286784|3,5-Bis(ethoxycarbonyl)pyridine|2-(2-nitro-1-phenylethyl)cyclohexan-1-one|Cyclohexanone, 2-(2-nitro-1-phenylethyl)-|2-(1-Phenyl-2-nitroethyl)cyclohexanone|2-(2-nitro-1-phenylethyl)cyclohexanone|2-(alpha-Nitromethylbenzyl)cyclohexanone|2-(2-nitro-1-phenyl-ethyl)-cyclohexanone|2-[alpha-(Nitromethyl)benzyl]cyclohexanone|2-(1-Phenyl-2-nitroethyl)cyclohexan-1-one|2-(2-Nitro-1-phenylethyl)-1-cyclohexanone
| Molecular Formula | C14H17NO3 |
|---|---|
| Molecular Weight | 247.12085 g/mol |
| LogP | 2.8062 |
| Topological Polar Surface Area | 60.21 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 247.12085 |
| Monoisotopic Mass | 247.12085 |
| Heavy Atoms | 18 |
| Complexity | 429.92505 |
Chemical Identifiers
| CAS Number | 4591-64-4 |
|---|---|
| SMILES | C1CCC(=O)C(C1)C(C[N+](=O)[O-])C2=CC=CC=C2 |
Product Overview
Cyclohexanone, 2-(2-nitro-1-phenylethyl)- (CAS 4591-64-4), with molecular formula C14H17NO3 and molecular weight 247.12085 g/mol. IUPAC: 2-(2-nitro-1-phenylethyl)cyclohexan-1-one.
Cyclohexanone, 2-(2-nitro-1-phenylethyl)- is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »