Carbonotrithioic acid, bis(trifluoromethyl) ester
bis(trifluoromethylsulfanyl)methanethione
Also Known As: Carbonotrithioic acid, bis(trifluoromethyl) ester|HELIOTROPYL ISO-BUTYRATE|bis(trifluoromethylsulfanyl)methanethione|bis(trifluoromethyl) carbonotrithioate|Bis(trifluoromethyl) trithiocarbonate #|Carbonic acid, trithio-, bis(trifluoromethyl) ester|Trithiocarbonic acid, bis(trifluoromethyl) ester|Carbonotrithioic acid,bis(trifluoromethyl) ester|Trithiocarbonic acid bis(trifluoromethyl) ester|CARBONOTRITHIOIC ACID BIS(TRIFLUOROMETHYL) ESTER|BIS[(TRIFLUOROMETHYL)SULFANYL]METHANETHIONE
| Molecular Formula | C3F6S3 |
|---|---|
| Molecular Weight | 245.90663 g/mol |
| LogP | 4.6 |
| Topological Polar Surface Area | 82.7 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Exact Mass | 245.90663 |
| Monoisotopic Mass | 245.90663 |
| Heavy Atoms | 12 |
| Complexity | 150.0 |
Chemical Identifiers
| CAS Number | 461-08-5 |
|---|---|
| SMILES | C(=S)(SC(F)(F)F)SC(F)(F)F |
| InChIKey | BHLMOIFXVOEGPU-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 1 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Carbonotrithioic acid, bis(trifluoromethyl) ester (CAS 461-08-5), with molecular formula C3F6S3 and molecular weight 245.90663 g/mol. IUPAC: bis(trifluoromethylsulfanyl)methanethione.