Ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate
ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate
Also Known As: ethyl 5-hydroxy-2-phenylbenzofuran-3-carboxylate|2-chloropiperidine|Ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate|5-Hydroxy-2-phenyl-benzofuran-3-carboxylic acid ethyl ester|Enamine_003668|CBDivE_000506|IDI1_007311|BAS 00583040|2-phenyl-3-carbethoxy-5-hydroxybenzofuran|ethyl 5-hydroxy-2-phenyl-benzofuran-3-carboxylate|J2.828.461F|AG-690/36539018|ethyl 5-hydroxy-2-phenylbenzo[b]furan-3-carboxylate|SR-01000410648-1
| Molecular Formula | C17H14O4 |
|---|---|
| Molecular Weight | 282.0892 g/mol |
| LogP | 3.9 |
| Topological Polar Surface Area | 59.7 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 282.0892 |
| Monoisotopic Mass | 282.0892 |
| Heavy Atoms | 21 |
| Complexity | 364.0 |
Chemical Identifiers
| CAS Number | 4610-75-7 |
|---|---|
| SMILES | CCOC(=O)C1=C(OC2=C1C=C(C=C2)O)C3=CC=CC=C3 |
| InChIKey | WZZJQHPNLFLEMB-UHFFFAOYSA-N |
Patent-Derived Application Labels
Derived from 2 IPC patent classification(s) across the SureChEMBL global patent database.
Product Overview
Ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate (CAS 4610-75-7), with molecular formula C17H14O4 and molecular weight 282.0892 g/mol. IUPAC: ethyl 5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate.