1,5-Pentylenediphosphonic Acid
5-phosphonopentylphosphonic acid
Also Known As: 5-phosphonopentylphosphonic Acid|1,5-PENTANEBISPHOSPHONIC ACID|1,5-Pentylenediphosphonic Acid|1,5-Diphosphonopentane|1,5-diphosphono-pentane|(5-phosphonopentyl)phosphonic acid|Pentane-1,5-bisphosphonic Acid|1,5-Pentanediphosphonic Acid|Pentane-1,5-diphosphonic acid|pentane-1,5-diyldiphosphonic acid|1,5-PentylenediphosphonicAcid|Pentamethylenebisphosphonic acid|1,5-Pentylenebisphosphonic acid|1,5-pentylene diphosphonic acid|1,5-PENTANEBISPHOSPHONICACID|1,5-Pentanediylbisphosphonic acid|Pentane-1,5-diylbisphosphonic acid|Pentane-1,5-diylbis(phosphonic acid)|KS-000017Q2|J1.058.695J|1,5-Pentylenediphosphonic Acid, inverted exclamation markO98%|811-150-9
| Molecular Formula | C5H14O6P2 |
|---|---|
| Molecular Weight | 232.02657 g/mol |
| LogP | 0.5121 |
| Topological Polar Surface Area | 115.06 Ų |
| Hydrogen Bond Donors | 4 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Exact Mass | 232.02657 |
| Monoisotopic Mass | 232.02657 |
| Heavy Atoms | 13 |
| Complexity | 203.17911 |
Chemical Identifiers
| CAS Number | 4672-25-7 |
|---|---|
| SMILES | C(CCP(=O)(O)O)CCP(=O)(O)O |
Product Overview
1,5-Pentylenediphosphonic Acid (CAS 4672-25-7), with molecular formula C5H14O6P2 and molecular weight 232.02657 g/mol. IUPAC: 5-phosphonopentylphosphonic acid.