1,3-Dibutyltetrahydro-2(1H)-pyrimidinone
1-(4-methoxyphenyl)-N-(2-phenylethyl)methanimine
Also Known As: 4-Methoxy-N-phenethylbenzenemethanimine|1,3-Dibutyltetrahydro-2(1H)-pyrimidinone|1,3-Dibutyl-tetrahydro-pyrimidin-2-one|1-(4-methoxyphenyl)-N-phenethylmethanimine|1-(4-methoxyphenyl)-N-phenethyl-methanimine|J1.640.333D|N-(4-Methoxybenzylidene)-2-phenylethaneamine|1-(4-methoxyphenyl)-N-(2-phenylethyl)methanimine|(E)-1-(4-Methoxyphenyl)-N-(2-phenylethyl)methanimine|1-((1E)-4-phenyl-2-azabut-1-enyl)-4-methoxybenzene|N-[(E)-(4-methoxyphenyl)methylidene]-2-phenylethanamine|[(4-METHOXYPHENYL)METHYLIDENE](2-PHENYLETHYL)AMINE
| Molecular Formula | C16H17NO |
|---|---|
| Molecular Weight | 239.13101 g/mol |
| LogP | 3.3568 |
| Topological Polar Surface Area | 21.59 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Exact Mass | 239.13101 |
| Monoisotopic Mass | 239.13101 |
| Heavy Atoms | 18 |
| Complexity | 488.26523 |
Chemical Identifiers
| CAS Number | 4673-45-4 |
|---|---|
| SMILES | COC1=CC=C(C=C1)C=NCCC2=CC=CC=C2 |
Product Overview
1,3-Dibutyltetrahydro-2(1H)-pyrimidinone (CAS 4673-45-4), with molecular formula C16H17NO and molecular weight 239.13101 g/mol. IUPAC: 1-(4-methoxyphenyl)-N-(2-phenylethyl)methanimine.
1,3-Dibutyltetrahydro-2(1H)-pyrimidinone is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »