Dimethyl 5,6-acenaphthenedicarboxylate
dimethyl 1,2-dihydroacenaphthylene-5,6-dicarboxylate
Also Known As: Dimethyl 5,6-acenaphthenedicarboxylate|Oprea1_157587|dimethyl 1,2-dihydroacenaphthylene-5,6-dicarboxylate|J1.769.870B|5,6-Acenaphthylenedicarboxylicacid, 1,2-dihydro-, 5,6-dimethyl ester|Acenaphthene-5,6-dicarboxylic acid dimethyl ester|AF-961/00487008|5,6-dimethyl 1,2-dihydroacenaphthylene-5,6-dicarboxylate|methyl 6-(methoxycarbonyl)acenaphthene-5-carboxylate|Dimethyl 1,2-dihydro-5,6-acenaphthylenedicarboxylate|Dimethyl 1,2-dihydro-5,6-acenaphthylenedicarboxylate #|1,2-Dihydroacenaphthylene-5,6-dicarboxylic acid dimethyl ester
| Molecular Formula | C16H14O4 |
|---|---|
| Molecular Weight | 270.0892 g/mol |
| LogP | 3.2 |
| Topological Polar Surface Area | 52.6 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Exact Mass | 270.0892 |
| Monoisotopic Mass | 270.0892 |
| Heavy Atoms | 20 |
| Complexity | 369.0 |
Chemical Identifiers
| CAS Number | 468-53-1 |
|---|---|
| SMILES | COC(=O)C1=C2C(=CC=C3C2=C(CC3)C=C1)C(=O)OC |
| InChIKey | KZDDQWFGWDKABI-UHFFFAOYSA-N |
Product Overview
Dimethyl 5,6-acenaphthenedicarboxylate (CAS 468-53-1), with molecular formula C16H14O4 and molecular weight 270.0892 g/mol. IUPAC: dimethyl 1,2-dihydroacenaphthylene-5,6-dicarboxylate.
Dimethyl 5,6-acenaphthenedicarboxylate is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »