![1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)-1H-benzo[d]imidazol-3-ium chloride structure](/static/products/468/468091-95-4.png)
1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)-1H-benzo[d]imidazol-3-ium chloride
1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)benzimidazol-3-ium chloride
Also Known As: 1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)-1H-benzo[d]imidazol-3-ium chloride|1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)benzimidazol-3-ium chloride|1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)benzoimidazole Chloride|1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)-1H-3,1-benzimidazol-3-ium chloride
| Molecular Formula | C18H21ClN2O3 |
|---|---|
| Molecular Weight | 348.12408 g/mol |
| LogP | -0.3004 |
| Topological Polar Surface Area | 36.5 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Exact Mass | 348.12408 |
| Monoisotopic Mass | 348.12408 |
| Heavy Atoms | 24 |
| Complexity | 810.06665 |
Chemical Identifiers
| CAS Number | 468091-95-4 |
|---|---|
| SMILES | CN1C2=CC=CC=C2[N+](=C1C3=CC(=C(C(=C3)OC)OC)OC)C.[Cl-] |
Product Overview
1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)-1H-benzo[d]imidazol-3-ium chloride (CAS 468091-95-4), with molecular formula C18H21ClN2O3 and molecular weight 348.12408 g/mol. IUPAC: 1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)benzimidazol-3-ium chloride.
1,3-dimethyl-2-(3,4,5-trimethoxyphenyl)-1H-benzo[d]imidazol-3-ium chloride is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »