(2E)-2-cyano-N-[4-(diethylamino)phenyl]-3-(4-methoxyphenyl)prop-2-enamide
(E)-2-cyano-N-[4-(diethylamino)phenyl]-3-(4-methoxyphenyl)prop-2-enamide
Also Known As: AB00682132-01|(2E)-2-cyano-N-[4-(diethylamino)phenyl]-3-(4-methoxyphenyl)prop-2-enamide|F3097-0860|(E)-2-cyano-N-[4-(diethylamino)phenyl]-3-(4-methoxyphenyl)prop-2-enamide|2-cyano-N-(4-diethylaminophenyl)-3-(4-methoxyphenyl)prop-2-enamide|(E)-2-cyano-N-(4-(diethylamino)phenyl)-3-(4-methoxyphenyl)acrylamide|(2E)-N-[4-(diethylamino)phenyl]-2-cyano-3-(4-methoxyphenyl)prop-2-enamide
| Molecular Formula | C21H23N3O2 |
|---|---|
| Molecular Weight | 349.17902 g/mol |
| LogP | 4.2 |
| Topological Polar Surface Area | 65.4 Ų |
| Hydrogen Bond Donors | 1 |
| Hydrogen Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Exact Mass | 349.17902 |
| Monoisotopic Mass | 349.17902 |
| Heavy Atoms | 26 |
| Complexity | 517.0 |
Chemical Identifiers
| CAS Number | 469870-52-8 |
|---|---|
| SMILES | CCN(CC)C1=CC=C(C=C1)NC(=O)/C(=C/C2=CC=C(C=C2)OC)/C#N |
| InChIKey | JMESLIHZAMZKFN-SAPNQHFASA-N |
Product Overview
(2E)-2-cyano-N-[4-(diethylamino)phenyl]-3-(4-methoxyphenyl)prop-2-enamide (CAS 469870-52-8), with molecular formula C21H23N3O2 and molecular weight 349.17902 g/mol. IUPAC: (E)-2-cyano-N-[4-(diethylamino)phenyl]-3-(4-methoxyphenyl)prop-2-enamide.
(2E)-2-cyano-N-[4-(diethylamino)phenyl]-3-(4-methoxyphenyl)prop-2-enamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »