4-Methyl-N-phenyl-N-(phenylmethyl)benzenesulfonamide
N-benzyl-4-methyl-N-phenylbenzenesulfonamide
Also Known As: Oprea1_001424|N-benzyl-4-methyl-N-phenylbenzenesulfonamide|N-BENZYL-4-METHYL-N-PHENYLBENZENE-1-SULFONAMIDE|N-Benzyl-N-phenyl-p-toluenesulfonamide|N-Phenyl-N-benzyl-p-toluenesulfonamide|HS-3249|[(4-methylphenyl)sulfonyl]phenylbenzylamine|N-Phenyl-N-benzyl-4-methylbenzenesulfonamide|J1.242.157E|4-Methyl-N-phenyl-N-(phenylmethyl)benzenesulfonamide|SR-01000418210-1
| Molecular Formula | C20H19NO2S |
|---|---|
| Molecular Weight | 337.11365 g/mol |
| LogP | 4.5 |
| Topological Polar Surface Area | 45.8 Ų |
| Hydrogen Bond Donors | 0 |
| Hydrogen Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Exact Mass | 337.11365 |
| Monoisotopic Mass | 337.11365 |
| Heavy Atoms | 24 |
| Complexity | 464.0 |
Chemical Identifiers
| CAS Number | 4703-20-2 |
|---|---|
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=CC=C2)C3=CC=CC=C3 |
| InChIKey | MHDGADJMKCLDOM-UHFFFAOYSA-N |
Product Overview
4-Methyl-N-phenyl-N-(phenylmethyl)benzenesulfonamide (CAS 4703-20-2), with molecular formula C20H19NO2S and molecular weight 337.11365 g/mol. IUPAC: N-benzyl-4-methyl-N-phenylbenzenesulfonamide.
4-Methyl-N-phenyl-N-(phenylmethyl)benzenesulfonamide is a custom synthesis product. We offer services from milligram to kilogram scale.
Request a Quote »